C19H30F3NO3S — CID 155170688
(9E,12E,15Z)-N-(trifluoromethylsulfonyl)octadeca-9,12,15-trienamide (PubChem CID 155170688) has the molecular formula C19H30F3NO3S and a molecular weight of 409.51 g/mol. Its IUPAC name is (9E,12E,15Z)-N-(trifluoromethylsulfonyl)octadeca-9,12,15-trienamide.
| Compound Name | (9E,12E,15Z)-N-(trifluoromethylsulfonyl)octadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 155170688 |
| Molecular Formula | C19H30F3NO3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (9E,12E,15Z)-N-(trifluoromethylsulfonyl)octadeca-9,12,15-trienamide |
| SMILES | CC/C=C\C/C=C/C/C=C/CCCCCCCC(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H30F3NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(24)23-27(25,26)19(20,21)22/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,23,24)/b4-3-,7-6+,10-9+ |
| InChIKey | ZPMBFJMAOKHTJA-YSFKBSJESA-N |
| XLogP | 5.54 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|