C32H42O10 — CID 172998334
2,2-bis(3,4,5-trihydroxybenzoyl)octadec-9-enoic acid (PubChem CID 172998334) has the molecular formula C32H42O10 and a molecular weight of 586.68 g/mol. Its IUPAC name is 2,2-bis(3,4,5-trihydroxybenzoyl)octadec-9-enoic acid.
| Compound Name | 2,2-bis(3,4,5-trihydroxybenzoyl)octadec-9-enoic acid |
|---|---|
| PubChem CID | 172998334 |
| Molecular Formula | C32H42O10 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 2,2-bis(3,4,5-trihydroxybenzoyl)octadec-9-enoic acid |
| SMILES | CCCCCCCCC=CCCCCCCC(C(=O)O)(C(=O)c1cc(O)c(O)c(O)c1)C(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C32H42O10/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-32(31(41)42,29(39)21-17-23(33)27(37)24(34)18-21)30(40)22-19-25(35)28(38)26(36)20-22/h9-10,17-20,33-38H,2-8,11-16H2,1H3,(H,41,42) |
| InChIKey | LOSXKRHONHSQHZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|