C15H30N2O — CID 172998500
6-amino-N,N-dibutyl-2-methylhex-2-enamide (PubChem CID 172998500) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 6-amino-N,N-dibutyl-2-methylhex-2-enamide.
| Compound Name | 6-amino-N,N-dibutyl-2-methylhex-2-enamide |
|---|---|
| PubChem CID | 172998500 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 6-amino-N,N-dibutyl-2-methylhex-2-enamide |
| SMILES | CCCCN(CCCC)C(=O)C(C)=CCCCN |
| InChI | InChI=1S/C15H30N2O/c1-4-6-12-17(13-7-5-2)15(18)14(3)10-8-9-11-16/h10H,4-9,11-13,16H2,1-3H3 |
| InChIKey | SSCALUWKLYRYAU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|