About bis(2-methylpropyl)alumanylium;octadec-9-enoate
bis(2-methylpropyl)alumanylium;octadec-9-enoate (PubChem CID 172999257) has the molecular formula C26H51AlO2
and a molecular weight of 422.67 g/mol. Its IUPAC name is bis(2-methylpropyl)alumanylium;octadec-9-enoate.
Molecular Properties
| Compound Name | bis(2-methylpropyl)alumanylium;octadec-9-enoate |
| PubChem CID | 172999257 |
| Molecular Formula | C26H51AlO2 |
| Molecular Weight | 422.67 g/mol |
| Exact Mass | 422.37 |
| IUPAC Name | bis(2-methylpropyl)alumanylium;octadec-9-enoate |
| SMILES | CC(C)C[Al+]CC(C)C.CCCCCCCCC=CCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H34O2.2C4H9.Al/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*1-4(2)3;/h9-10H,2-8,11-17H2,1H3,(H,19,20);2*4H,1H2,2-3H3;/q;;;+1/p-1 |
| InChIKey | ZNFFVMBDCGTOJK-UHFFFAOYSA-M |
| XLogP | 7.61 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.67 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpropyl)alumanylium;octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropyl)alumanylium;octadec-9-enoate?
The IUPAC name of bis(2-methylpropyl)alumanylium;octadec-9-enoate (CID 172999257) is bis(2-methylpropyl)alumanylium;octadec-9-enoate.
What is the SMILES notation for bis(2-methylpropyl)alumanylium;octadec-9-enoate?
The canonical SMILES for bis(2-methylpropyl)alumanylium;octadec-9-enoate is CC(C)C[Al+]CC(C)C.CCCCCCCCC=CCCCCCCCC(=O)[O-].
What is the InChIKey of bis(2-methylpropyl)alumanylium;octadec-9-enoate?
The InChIKey is ZNFFVMBDCGTOJK-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H34O2.2C4H9.Al/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*1-4(2)3;/h9-10H,2-8,11-17H2,1H3,(H,19,20);2*4H,1H2,2-3H3;/q;;;+1/p-1.
What are the key properties of bis(2-methylpropyl)alumanylium;octadec-9-enoate?
bis(2-methylpropyl)alumanylium;octadec-9-enoate has a molecular weight of 422.67 g/mol, XLogP of 7.61, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl)alumanylium;octadec-9-enoate is sourced from PubChem (CID 172999257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).