C15H18ClN5O3S — CID 173001166
[1-[(2-chlorophenyl)methylamino]-3-(methylamino)-3-oxopropyl] N-(5-methyl-1,3,4-thiadiazol-2-yl)carbamate (PubChem CID 173001166) has the molecular formula C15H18ClN5O3S and a molecular weight of 383.86 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methylamino]-3-(methylamino)-3-oxopropyl] N-(5-methyl-1,3,4-thiadiazol-2-yl)carbamate.
| Compound Name | [1-[(2-chlorophenyl)methylamino]-3-(methylamino)-3-oxopropyl] N-(5-methyl-1,3,4-thiadiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 173001166 |
| Molecular Formula | C15H18ClN5O3S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | [1-[(2-chlorophenyl)methylamino]-3-(methylamino)-3-oxopropyl] N-(5-methyl-1,3,4-thiadiazol-2-yl)carbamate |
| SMILES | CNC(=O)CC(NCc1ccccc1Cl)OC(=O)Nc1nnc(C)s1 |
| InChI | InChI=1S/C15H18ClN5O3S/c1-9-20-21-14(25-9)19-15(23)24-13(7-12(22)17-2)18-8-10-5-3-4-6-11(10)16/h3-6,13,18H,7-8H2,1-2H3,(H,17,22)(H,19,21,23) |
| InChIKey | VEIFOFUGCARJFS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|