C20H21ClN4O3S — CID 173001172
[1-[(2-chlorophenyl)methylamino]-3-(methylamino)-3-oxopropyl] N-(4-methyl-1,3-benzothiazol-2-yl)carbamate (PubChem CID 173001172) has the molecular formula C20H21ClN4O3S and a molecular weight of 432.93 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methylamino]-3-(methylamino)-3-oxopropyl] N-(4-methyl-1,3-benzothiazol-2-yl)carbamate.
| Compound Name | [1-[(2-chlorophenyl)methylamino]-3-(methylamino)-3-oxopropyl] N-(4-methyl-1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 173001172 |
| Molecular Formula | C20H21ClN4O3S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | [1-[(2-chlorophenyl)methylamino]-3-(methylamino)-3-oxopropyl] N-(4-methyl-1,3-benzothiazol-2-yl)carbamate |
| SMILES | CNC(=O)CC(NCc1ccccc1Cl)OC(=O)Nc1nc2c(C)cccc2s1 |
| InChI | InChI=1S/C20H21ClN4O3S/c1-12-6-5-9-15-18(12)24-19(29-15)25-20(27)28-17(10-16(26)22-2)23-11-13-7-3-4-8-14(13)21/h3-9,17,23H,10-11H2,1-2H3,(H,22,26)(H,24,25,27) |
| InChIKey | BXYVDUNSRTYADA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|