C16H30O3Si — CID 173001338
8-cyclopenta-1,4-dien-1-yloctyl(trimethoxy)silane (PubChem CID 173001338) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is 8-cyclopenta-1,4-dien-1-yloctyl(trimethoxy)silane.
| Compound Name | 8-cyclopenta-1,4-dien-1-yloctyl(trimethoxy)silane |
|---|---|
| PubChem CID | 173001338 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 8-cyclopenta-1,4-dien-1-yloctyl(trimethoxy)silane |
| SMILES | CO[Si](CCCCCCCCC1=CCC=C1)(OC)OC |
| InChI | InChI=1S/C16H30O3Si/c1-17-20(18-2,19-3)15-11-7-5-4-6-8-12-16-13-9-10-14-16/h9,13-14H,4-8,10-12,15H2,1-3H3 |
| InChIKey | FGORPMJCKSKZQM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|