About benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride
benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride (PubChem CID 173002357) has the molecular formula C18H19F2NO2S2
and a molecular weight of 383.49 g/mol. Its IUPAC name is benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride.
Molecular Properties
| Compound Name | benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride |
| PubChem CID | 173002357 |
| Molecular Formula | C18H19F2NO2S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride |
| SMILES | CC(C)c1cccc(C(=O)S)c1C#N.F.F.O=C(S)c1ccccc1 |
| InChI | InChI=1S/C11H11NOS.C7H6OS.2FH/c1-7(2)8-4-3-5-9(11(13)14)10(8)6-12;8-7(9)6-4-2-1-3-5-6;;/h3-5,7H,1-2H3,(H,13,14);1-5H,(H,8,9);2*1H |
| InChIKey | CZAXUIZVHTZIFO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 57.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride?
The IUPAC name of benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride (CID 173002357) is benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride.
What is the SMILES notation for benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride?
The canonical SMILES for benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride is CC(C)c1cccc(C(=O)S)c1C#N.F.F.O=C(S)c1ccccc1.
What is the InChIKey of benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride?
The InChIKey is CZAXUIZVHTZIFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS.C7H6OS.2FH/c1-7(2)8-4-3-5-9(11(13)14)10(8)6-12;8-7(9)6-4-2-1-3-5-6;;/h3-5,7H,1-2H3,(H,13,14);1-5H,(H,8,9);2*1H.
What are the key properties of benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride?
benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride has a molecular weight of 383.49 g/mol, XLogP of 4.81, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarbothioic S-acid;2-cyano-3-propan-2-ylbenzenecarbothioic S-acid;dihydrofluoride is sourced from PubChem (CID 173002357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).