C20H23N3O8S — CID 173004186
but-2-enedioic acid;3-[1-[4-[(dimethylamino)methyl]phenyl]sulfonylpyrrol-3-yl]-N-hydroxyprop-2-enamide (PubChem CID 173004186) has the molecular formula C20H23N3O8S and a molecular weight of 465.48 g/mol. Its IUPAC name is but-2-enedioic acid;3-[1-[4-[(dimethylamino)methyl]phenyl]sulfonylpyrrol-3-yl]-N-hydroxyprop-2-enamide.
| Compound Name | but-2-enedioic acid;3-[1-[4-[(dimethylamino)methyl]phenyl]sulfonylpyrrol-3-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 173004186 |
| Molecular Formula | C20H23N3O8S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | but-2-enedioic acid;3-[1-[4-[(dimethylamino)methyl]phenyl]sulfonylpyrrol-3-yl]-N-hydroxyprop-2-enamide |
| SMILES | CN(C)Cc1ccc(S(=O)(=O)n2ccc(C=CC(=O)NO)c2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H19N3O4S.C4H4O4/c1-18(2)11-13-3-6-15(7-4-13)24(22,23)19-10-9-14(12-19)5-8-16(20)17-21;5-3(6)1-2-4(7)8/h3-10,12,21H,11H2,1-2H3,(H,17,20);1-2H,(H,5,6)(H,7,8) |
| InChIKey | DJEPPWBRMHYGAB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 166.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|