About [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane
[2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane (PubChem CID 173008314) has the molecular formula C25H48O4Si
and a molecular weight of 440.74 g/mol. Its IUPAC name is [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane.
Molecular Properties
| Compound Name | [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane |
| PubChem CID | 173008314 |
| Molecular Formula | C25H48O4Si |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane |
| SMILES | C/C=C(/C)OC(C)CCC(CCC(C)O/C(C)=C\C)(CCC(C)O/C(C)=C\C)O[SiH3] |
| InChI | InChI=1S/C25H48O4Si/c1-10-19(4)26-22(7)13-16-25(29-30,17-14-23(8)27-20(5)11-2)18-15-24(9)28-21(6)12-3/h10-12,22-24H,13-18H2,1-9,30H3/b19-10-,20-11-,21-12- |
| InChIKey | MYNRQBYHGOTIFM-XWBZMVROSA-N |
| XLogP | 6.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane?
The IUPAC name of [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane (CID 173008314) is [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane.
What is the SMILES notation for [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane?
The canonical SMILES for [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane is C/C=C(/C)OC(C)CCC(CCC(C)O/C(C)=C\C)(CCC(C)O/C(C)=C\C)O[SiH3].
What is the InChIKey of [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane?
The InChIKey is MYNRQBYHGOTIFM-XWBZMVROSA-N. The full InChI is InChI=1S/C25H48O4Si/c1-10-19(4)26-22(7)13-16-25(29-30,17-14-23(8)27-20(5)11-2)18-15-24(9)28-21(6)12-3/h10-12,22-24H,13-18H2,1-9,30H3/b19-10-,20-11-,21-12-.
What are the key properties of [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane?
[2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane has a molecular weight of 440.74 g/mol, XLogP of 6.35, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,8-bis[[(Z)-but-2-en-2-yl]oxy]-5-[3-[(Z)-but-2-en-2-yl]oxybutyl]nonan-5-yl]oxysilane is sourced from PubChem (CID 173008314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).