About boric acid;hafnium;trihydrochloride
boric acid;hafnium;trihydrochloride (PubChem CID 173011670) has the molecular formula H6BCl3HfO3
and a molecular weight of 349.71 g/mol. Its IUPAC name is boric acid;hafnium;trihydrochloride.
Molecular Properties
| Compound Name | boric acid;hafnium;trihydrochloride |
| PubChem CID | 173011670 |
| Molecular Formula | H6BCl3HfO3 |
| Molecular Weight | 349.71 g/mol |
| Exact Mass | 349.89 |
| IUPAC Name | boric acid;hafnium;trihydrochloride |
| SMILES | Cl.Cl.Cl.OB(O)O.[Hf] |
| InChI | InChI=1S/BH3O3.3ClH.Hf/c2-1(3)4;;;;/h2-4H;3*1H; |
| InChIKey | VFYQAHLQUZWSTO-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.71 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;hafnium;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;hafnium;trihydrochloride?
The IUPAC name of boric acid;hafnium;trihydrochloride (CID 173011670) is boric acid;hafnium;trihydrochloride.
What is the SMILES notation for boric acid;hafnium;trihydrochloride?
The canonical SMILES for boric acid;hafnium;trihydrochloride is Cl.Cl.Cl.OB(O)O.[Hf].
What is the InChIKey of boric acid;hafnium;trihydrochloride?
The InChIKey is VFYQAHLQUZWSTO-UHFFFAOYSA-N. The full InChI is InChI=1S/BH3O3.3ClH.Hf/c2-1(3)4;;;;/h2-4H;3*1H;.
What are the key properties of boric acid;hafnium;trihydrochloride?
boric acid;hafnium;trihydrochloride has a molecular weight of 349.71 g/mol, XLogP of -0.79, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;hafnium;trihydrochloride is sourced from PubChem (CID 173011670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).