C16H37NO4Si — CID 173014058
4-diethoxysilyl-N,N-bis(1-ethoxyethyl)butan-1-amine (PubChem CID 173014058) has the molecular formula C16H37NO4Si and a molecular weight of 335.56 g/mol. Its IUPAC name is 4-diethoxysilyl-N,N-bis(1-ethoxyethyl)butan-1-amine.
| Compound Name | 4-diethoxysilyl-N,N-bis(1-ethoxyethyl)butan-1-amine |
|---|---|
| PubChem CID | 173014058 |
| Molecular Formula | C16H37NO4Si |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 4-diethoxysilyl-N,N-bis(1-ethoxyethyl)butan-1-amine |
| SMILES | CCOC(C)N(CCCC[SiH](OCC)OCC)C(C)OCC |
| InChI | InChI=1S/C16H37NO4Si/c1-7-18-15(5)17(16(6)19-8-2)13-11-12-14-22(20-9-3)21-10-4/h15-16,22H,7-14H2,1-6H3 |
| InChIKey | XKSVOPBXGYHJFX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|