C17H39NO3Si — CID 173014057
N,N-bis(1-ethoxyethyl)-5-ethyl-5-silyloxyheptan-1-amine (PubChem CID 173014057) has the molecular formula C17H39NO3Si and a molecular weight of 333.59 g/mol. Its IUPAC name is N,N-bis(1-ethoxyethyl)-5-ethyl-5-silyloxyheptan-1-amine.
| Compound Name | N,N-bis(1-ethoxyethyl)-5-ethyl-5-silyloxyheptan-1-amine |
|---|---|
| PubChem CID | 173014057 |
| Molecular Formula | C17H39NO3Si |
| Molecular Weight | 333.59 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | N,N-bis(1-ethoxyethyl)-5-ethyl-5-silyloxyheptan-1-amine |
| SMILES | CCOC(C)N(CCCCC(CC)(CC)O[SiH3])C(C)OCC |
| InChI | InChI=1S/C17H39NO3Si/c1-7-17(8-2,21-22)13-11-12-14-18(15(5)19-9-3)16(6)20-10-4/h15-16H,7-14H2,1-6,22H3 |
| InChIKey | SGJKACZPKYDAMO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|