C14H33NO3Si — CID 123801657
N,N-bis(ethoxymethyl)-4-ethyl-4-silyloxyhexan-1-amine (PubChem CID 123801657) has the molecular formula C14H33NO3Si and a molecular weight of 291.51 g/mol. Its IUPAC name is N,N-bis(ethoxymethyl)-4-ethyl-4-silyloxyhexan-1-amine.
| Compound Name | N,N-bis(ethoxymethyl)-4-ethyl-4-silyloxyhexan-1-amine |
|---|---|
| PubChem CID | 123801657 |
| Molecular Formula | C14H33NO3Si |
| Molecular Weight | 291.51 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N,N-bis(ethoxymethyl)-4-ethyl-4-silyloxyhexan-1-amine |
| SMILES | CCOCN(CCCC(CC)(CC)O[SiH3])COCC |
| InChI | InChI=1S/C14H33NO3Si/c1-5-14(6-2,18-19)10-9-11-15(12-16-7-3)13-17-8-4/h5-13H2,1-4,19H3 |
| InChIKey | IBBVIXKQZUEENE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|