C16H37NO7P2 — CID 87357769
N,N-bis(2-diethoxyphosphorylethyl)-1-ethoxyethanamine (PubChem CID 87357769) has the molecular formula C16H37NO7P2 and a molecular weight of 417.42 g/mol. Its IUPAC name is N,N-bis(2-diethoxyphosphorylethyl)-1-ethoxyethanamine.
| Compound Name | N,N-bis(2-diethoxyphosphorylethyl)-1-ethoxyethanamine |
|---|---|
| PubChem CID | 87357769 |
| Molecular Formula | C16H37NO7P2 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | N,N-bis(2-diethoxyphosphorylethyl)-1-ethoxyethanamine |
| SMILES | CCOC(C)N(CCP(=O)(OCC)OCC)CCP(=O)(OCC)OCC |
| InChI | InChI=1S/C16H37NO7P2/c1-7-20-16(6)17(12-14-25(18,21-8-2)22-9-3)13-15-26(19,23-10-4)24-11-5/h16H,7-15H2,1-6H3 |
| InChIKey | MZQIBEOUUGVAOV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|