C11H19N2O5P — CID 11778943
3-amino-4-[2-diethoxyphosphorylethyl(methyl)amino]cyclobut-3-ene-1,2-dione (PubChem CID 11778943) has the molecular formula C11H19N2O5P and a molecular weight of 290.26 g/mol. Its IUPAC name is 3-amino-4-[2-diethoxyphosphorylethyl(methyl)amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[2-diethoxyphosphorylethyl(methyl)amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 11778943 |
| Molecular Formula | C11H19N2O5P |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3-amino-4-[2-diethoxyphosphorylethyl(methyl)amino]cyclobut-3-ene-1,2-dione |
| SMILES | CCOP(=O)(CCN(C)c1c(N)c(=O)c1=O)OCC |
| InChI | InChI=1S/C11H19N2O5P/c1-4-17-19(16,18-5-2)7-6-13(3)9-8(12)10(14)11(9)15/h4-7,12H2,1-3H3 |
| InChIKey | GUYPJCGWRHPKJD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|