C17H34N2NaS2 — CID 173014800
CID 173014800 (PubChem CID 173014800) has the molecular formula C17H34N2NaS2 and a molecular weight of 353.60 g/mol.
| Compound Name | CID 173014800 |
|---|---|
| PubChem CID | 173014800 |
| Molecular Formula | C17H34N2NaS2 |
| Molecular Weight | 353.60 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | — |
| SMILES | NCCC1CCCCC1.S=C(S)NCCC1CCCCC1.[Na] |
| InChI | InChI=1S/C9H17NS2.C8H17N.Na/c11-9(12)10-7-6-8-4-2-1-3-5-8;9-7-6-8-4-2-1-3-5-8;/h8H,1-7H2,(H2,10,11,12);8H,1-7,9H2; |
| InChIKey | YULWJCYGPLZJHP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|