About 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate
2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate (PubChem CID 88695054) has the molecular formula C17H31NS2
and a molecular weight of 313.58 g/mol. Its IUPAC name is 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate.
Molecular Properties
| Compound Name | 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate |
| PubChem CID | 88695054 |
| Molecular Formula | C17H31NS2 |
| Molecular Weight | 313.58 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate |
| SMILES | S=C(NCCC1CCCCC1)SCCC1CCCCC1 |
| InChI | InChI=1S/C17H31NS2/c19-17(18-13-11-15-7-3-1-4-8-15)20-14-12-16-9-5-2-6-10-16/h15-16H,1-14H2,(H,18,19) |
| InChIKey | WMSPPPFDCBTYFP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate?
The IUPAC name of 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate (CID 88695054) is 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate.
What is the SMILES notation for 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate?
The canonical SMILES for 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate is S=C(NCCC1CCCCC1)SCCC1CCCCC1.
What is the InChIKey of 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate?
The InChIKey is WMSPPPFDCBTYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NS2/c19-17(18-13-11-15-7-3-1-4-8-15)20-14-12-16-9-5-2-6-10-16/h15-16H,1-14H2,(H,18,19).
What are the key properties of 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate?
2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate has a molecular weight of 313.58 g/mol, XLogP of 5.53, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylethyl N-(2-cyclohexylethyl)carbamodithioate is sourced from PubChem (CID 88695054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).