About 8-ethyldodec-5-ene
8-ethyldodec-5-ene (PubChem CID 173018114) has the molecular formula C14H28
and a molecular weight of 196.38 g/mol. Its IUPAC name is 8-ethyldodec-5-ene.
Molecular Properties
| Compound Name | 8-ethyldodec-5-ene |
| PubChem CID | 173018114 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 8-ethyldodec-5-ene |
| SMILES | CCCCC=CCC(CC)CCCC |
| InChI | InChI=1S/C14H28/c1-4-7-9-10-11-13-14(6-3)12-8-5-2/h10-11,14H,4-9,12-13H2,1-3H3 |
| InChIKey | VLPFSHDINRDWRV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-ethyldodec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyldodec-5-ene?
The IUPAC name of 8-ethyldodec-5-ene (CID 173018114) is 8-ethyldodec-5-ene.
What is the SMILES notation for 8-ethyldodec-5-ene?
The canonical SMILES for 8-ethyldodec-5-ene is CCCCC=CCC(CC)CCCC.
What is the InChIKey of 8-ethyldodec-5-ene?
The InChIKey is VLPFSHDINRDWRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28/c1-4-7-9-10-11-13-14(6-3)12-8-5-2/h10-11,14H,4-9,12-13H2,1-3H3.
What are the key properties of 8-ethyldodec-5-ene?
8-ethyldodec-5-ene has a molecular weight of 196.38 g/mol, XLogP of 5.34, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyldodec-5-ene is sourced from PubChem (CID 173018114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).