About azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride
azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride (PubChem CID 173020115) has the molecular formula C10H24ClN3O2
and a molecular weight of 253.77 g/mol. Its IUPAC name is azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride.
Molecular Properties
| Compound Name | azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride |
| PubChem CID | 173020115 |
| Molecular Formula | C10H24ClN3O2 |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride |
| SMILES | C=C(CCNCC=C(C)C)C(=O)O.Cl.N.N |
| InChI | InChI=1S/C10H17NO2.ClH.2H3N/c1-8(2)4-6-11-7-5-9(3)10(12)13;;;/h4,11H,3,5-7H2,1-2H3,(H,12,13);1H;2*1H3 |
| InChIKey | VJHJSDAEKUSRTO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride?
The IUPAC name of azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride (CID 173020115) is azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride.
What is the SMILES notation for azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride?
The canonical SMILES for azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride is C=C(CCNCC=C(C)C)C(=O)O.Cl.N.N.
What is the InChIKey of azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride?
The InChIKey is VJHJSDAEKUSRTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2.ClH.2H3N/c1-8(2)4-6-11-7-5-9(3)10(12)13;;;/h4,11H,3,5-7H2,1-2H3,(H,12,13);1H;2*1H3.
What are the key properties of azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride?
azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride has a molecular weight of 253.77 g/mol, XLogP of 2.32, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride is sourced from PubChem (CID 173020115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).