C18H27F2NO3S — CID 173025834
tert-butyl-[[(1S)-4-carboxy-1-(3,5-difluorophenyl)-3,4-dimethylpentyl]amino]-oxidosulfanium (PubChem CID 173025834) has the molecular formula C18H27F2NO3S and a molecular weight of 375.48 g/mol. Its IUPAC name is tert-butyl-[[(1S)-4-carboxy-1-(3,5-difluorophenyl)-3,4-dimethylpentyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-4-carboxy-1-(3,5-difluorophenyl)-3,4-dimethylpentyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 173025834 |
| Molecular Formula | C18H27F2NO3S |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | tert-butyl-[[(1S)-4-carboxy-1-(3,5-difluorophenyl)-3,4-dimethylpentyl]amino]-oxidosulfanium |
| SMILES | CC(C[C@H](N[S+]([O-])C(C)(C)C)c1cc(F)cc(F)c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C18H27F2NO3S/c1-11(18(5,6)16(22)23)7-15(21-25(24)17(2,3)4)12-8-13(19)10-14(20)9-12/h8-11,15,21H,7H2,1-6H3,(H,22,23)/t11?,15-,25?/m0/s1 |
| InChIKey | JPVPDHDVIMOEJR-BECYFJKCSA-N |
| XLogP | 4.19 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|