About 4-ethylnonan-5-ylbenzene
4-ethylnonan-5-ylbenzene (PubChem CID 173025957) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is 4-ethylnonan-5-ylbenzene.
Molecular Properties
| Compound Name | 4-ethylnonan-5-ylbenzene |
| PubChem CID | 173025957 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 4-ethylnonan-5-ylbenzene |
| SMILES | CCCCC(c1ccccc1)C(CC)CCC |
| InChI | InChI=1S/C17H28/c1-4-7-14-17(15(6-3)11-5-2)16-12-9-8-10-13-16/h8-10,12-13,15,17H,4-7,11,14H2,1-3H3 |
| InChIKey | JRPHAGIZBPPFLN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-ethylnonan-5-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylnonan-5-ylbenzene?
The IUPAC name of 4-ethylnonan-5-ylbenzene (CID 173025957) is 4-ethylnonan-5-ylbenzene.
What is the SMILES notation for 4-ethylnonan-5-ylbenzene?
The canonical SMILES for 4-ethylnonan-5-ylbenzene is CCCCC(c1ccccc1)C(CC)CCC.
What is the InChIKey of 4-ethylnonan-5-ylbenzene?
The InChIKey is JRPHAGIZBPPFLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28/c1-4-7-14-17(15(6-3)11-5-2)16-12-9-8-10-13-16/h8-10,12-13,15,17H,4-7,11,14H2,1-3H3.
What are the key properties of 4-ethylnonan-5-ylbenzene?
4-ethylnonan-5-ylbenzene has a molecular weight of 232.41 g/mol, XLogP of 5.79, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylnonan-5-ylbenzene is sourced from PubChem (CID 173025957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).