C36H74O13S3Si3 — CID 173026603
[2-[[[2-(acetyloxymethyl)-3-ethoxy-3-ethoxysilyloxy-2-ethyl-6-sulfanylhexoxy]-(3-acetylsulfanylpropyl)-ethoxysilyl]oxymethyl]-3-ethoxy-2-ethyl-3-methylsilyloxy-6-sulfanylhexyl] acetate (PubChem CID 173026603) has the molecular formula C36H74O13S3Si3 and a molecular weight of 895.43 g/mol. Its IUPAC name is [2-[[[2-(acetyloxymethyl)-3-ethoxy-3-ethoxysilyloxy-2-ethyl-6-sulfanylhexoxy]-(3-acetylsulfanylpropyl)-ethoxysilyl]oxymethyl]-3-ethoxy-2-ethyl-3-methylsilyloxy-6-sulfanylhexyl] acetate.
| Compound Name | [2-[[[2-(acetyloxymethyl)-3-ethoxy-3-ethoxysilyloxy-2-ethyl-6-sulfanylhexoxy]-(3-acetylsulfanylpropyl)-ethoxysilyl]oxymethyl]-3-ethoxy-2-ethyl-3-methylsilyloxy-6-sulfanylhexyl] acetate |
|---|---|
| PubChem CID | 173026603 |
| Molecular Formula | C36H74O13S3Si3 |
| Molecular Weight | 895.43 g/mol |
| Exact Mass | 894.36 |
| IUPAC Name | [2-[[[2-(acetyloxymethyl)-3-ethoxy-3-ethoxysilyloxy-2-ethyl-6-sulfanylhexoxy]-(3-acetylsulfanylpropyl)-ethoxysilyl]oxymethyl]-3-ethoxy-2-ethyl-3-methylsilyloxy-6-sulfanylhexyl] acetate |
| SMILES | CCO[SiH2]OC(CCCS)(OCC)C(CC)(COC(C)=O)CO[Si](CCCSC(C)=O)(OCC)OCC(CC)(COC(C)=O)C(CCCS)(OCC)O[SiH2]C |
| InChI | InChI=1S/C36H74O13S3Si3/c1-11-33(26-40-30(7)37,35(42-13-3,48-53-10)20-17-22-50)28-46-55(45-16-6,25-19-24-52-32(9)39)47-29-34(12-2,27-41-31(8)38)36(43-14-4,21-18-23-51)49-54-44-15-5/h50-51H,11-29,53-54H2,1-10H3 |
| InChIKey | KTRYXVFIPSQSHA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 143.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|