C44H90O13S2Si2 — CID 173026618
[3-[2,2-bis(hydroxymethyl)butoxy]-2-[[2,2-bis(hydroxymethyl)butoxy-ethoxy-(3-octanoylsulfanylpropyl)silyl]oxymethyl]-3-ethoxysilyloxy-2-ethyl-6-sulfanylhexyl] octanoate (PubChem CID 173026618) has the molecular formula C44H90O13S2Si2 and a molecular weight of 947.50 g/mol. Its IUPAC name is [3-[2,2-bis(hydroxymethyl)butoxy]-2-[[2,2-bis(hydroxymethyl)butoxy-ethoxy-(3-octanoylsulfanylpropyl)silyl]oxymethyl]-3-ethoxysilyloxy-2-ethyl-6-sulfanylhexyl] octanoate.
| Compound Name | [3-[2,2-bis(hydroxymethyl)butoxy]-2-[[2,2-bis(hydroxymethyl)butoxy-ethoxy-(3-octanoylsulfanylpropyl)silyl]oxymethyl]-3-ethoxysilyloxy-2-ethyl-6-sulfanylhexyl] octanoate |
|---|---|
| PubChem CID | 173026618 |
| Molecular Formula | C44H90O13S2Si2 |
| Molecular Weight | 947.50 g/mol |
| Exact Mass | 946.54 |
| IUPAC Name | [3-[2,2-bis(hydroxymethyl)butoxy]-2-[[2,2-bis(hydroxymethyl)butoxy-ethoxy-(3-octanoylsulfanylpropyl)silyl]oxymethyl]-3-ethoxysilyloxy-2-ethyl-6-sulfanylhexyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(CC)(CO[Si](CCCSC(=O)CCCCCCC)(OCC)OCC(CC)(CO)CO)C(CCCS)(OCC(CC)(CO)CO)O[SiH2]OCC |
| InChI | InChI=1S/C44H90O13S2Si2/c1-8-15-17-19-21-25-39(49)51-37-43(12-5,44(27-23-28-58,57-60-53-13-6)52-35-41(10-3,31-45)32-46)38-56-61(54-14-7,55-36-42(11-4,33-47)34-48)30-24-29-59-40(50)26-22-20-18-16-9-2/h45-48,58H,8-38,60H2,1-7H3 |
| InChIKey | BCSIPYCKHXVAKV-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 179.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.50 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|