C6H7F9Si — CID 173028512
tris(1,1,2-trifluoroethyl)silane (PubChem CID 173028512) has the molecular formula C6H7F9Si and a molecular weight of 278.19 g/mol. Its IUPAC name is tris(1,1,2-trifluoroethyl)silane.
| Compound Name | tris(1,1,2-trifluoroethyl)silane |
|---|---|
| PubChem CID | 173028512 |
| Molecular Formula | C6H7F9Si |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | tris(1,1,2-trifluoroethyl)silane |
| SMILES | FCC(F)(F)[SiH](C(F)(F)CF)C(F)(F)CF |
| InChI | InChI=1S/C6H7F9Si/c7-1-4(10,11)16(5(12,13)2-8)6(14,15)3-9/h16H,1-3H2 |
| InChIKey | FUKCKWYJSSVUCE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|