C20H25N3O8 — CID 173032201
2-[[C-[(2S,4R)-4-methoxy-1-phenylmethoxycarbonylpyrrolidin-2-yl]-N-methylcarbonimidoyl]amino]oxy-3-methylbut-2-enedioic acid (PubChem CID 173032201) has the molecular formula C20H25N3O8 and a molecular weight of 435.43 g/mol. Its IUPAC name is 2-[[C-[(2S,4R)-4-methoxy-1-phenylmethoxycarbonylpyrrolidin-2-yl]-N-methylcarbonimidoyl]amino]oxy-3-methylbut-2-enedioic acid.
| Compound Name | 2-[[C-[(2S,4R)-4-methoxy-1-phenylmethoxycarbonylpyrrolidin-2-yl]-N-methylcarbonimidoyl]amino]oxy-3-methylbut-2-enedioic acid |
|---|---|
| PubChem CID | 173032201 |
| Molecular Formula | C20H25N3O8 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-[[C-[(2S,4R)-4-methoxy-1-phenylmethoxycarbonylpyrrolidin-2-yl]-N-methylcarbonimidoyl]amino]oxy-3-methylbut-2-enedioic acid |
| SMILES | C/N=C(\NOC(C(=O)O)=C(C)C(=O)O)[C@@H]1C[C@@H](OC)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H25N3O8/c1-12(18(24)25)16(19(26)27)31-22-17(21-2)15-9-14(29-3)10-23(15)20(28)30-11-13-7-5-4-6-8-13/h4-8,14-15H,9-11H2,1-3H3,(H,21,22)(H,24,25)(H,26,27)/t14-,15+/m1/s1 |
| InChIKey | NAVYOSFZQKHDNH-CABCVRRESA-N |
| XLogP | 1.41 |
| TPSA | 146.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|