C23H27N7O2 — CID 173034464
5-(3-hydroxyiminopyrrolidin-1-yl)-3-methyl-7-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[4,3-d]pyrimidin-4-one (PubChem CID 173034464) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 5-(3-hydroxyiminopyrrolidin-1-yl)-3-methyl-7-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 5-(3-hydroxyiminopyrrolidin-1-yl)-3-methyl-7-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 173034464 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 5-(3-hydroxyiminopyrrolidin-1-yl)-3-methyl-7-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[4,3-d]pyrimidin-4-one |
| SMILES | CN1CCN(c2ccc(-c3cc4ncn(C)c(=O)c4c(N4CCC(=NO)C4)n3)cc2)CC1 |
| InChI | InChI=1S/C23H27N7O2/c1-27-9-11-29(12-10-27)18-5-3-16(4-6-18)19-13-20-21(23(31)28(2)15-24-20)22(25-19)30-8-7-17(14-30)26-32/h3-6,13,15,32H,7-12,14H2,1-2H3 |
| InChIKey | GBDDPDAZZOOWAM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|