C13H20O7 — CID 173034674
8-hydroxy-3,4-bis(methoxycarbonyl)-2-methyloct-3-enoic acid (PubChem CID 173034674) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is 8-hydroxy-3,4-bis(methoxycarbonyl)-2-methyloct-3-enoic acid.
| Compound Name | 8-hydroxy-3,4-bis(methoxycarbonyl)-2-methyloct-3-enoic acid |
|---|---|
| PubChem CID | 173034674 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 8-hydroxy-3,4-bis(methoxycarbonyl)-2-methyloct-3-enoic acid |
| SMILES | COC(=O)C(CCCCO)=C(C(=O)OC)C(C)C(=O)O |
| InChI | InChI=1S/C13H20O7/c1-8(11(15)16)10(13(18)20-3)9(12(17)19-2)6-4-5-7-14/h8,14H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | KJSIRUCEMZVJJR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|