About methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol
methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol (PubChem CID 174878856) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol.
Molecular Properties
| Compound Name | methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol |
| PubChem CID | 174878856 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol |
| SMILES | C=C(CCCCO)C(=O)OC.C=CCO |
| InChI | InChI=1S/C8H14O3.C3H6O/c1-7(8(10)11-2)5-3-4-6-9;1-2-3-4/h9H,1,3-6H2,2H3;2,4H,1,3H2 |
| InChIKey | JRIAYSKICFTNGQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol?
The IUPAC name of methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol (CID 174878856) is methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol.
What is the SMILES notation for methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol?
The canonical SMILES for methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol is C=C(CCCCO)C(=O)OC.C=CCO.
What is the InChIKey of methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol?
The InChIKey is JRIAYSKICFTNGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3.C3H6O/c1-7(8(10)11-2)5-3-4-6-9;1-2-3-4/h9H,1,3-6H2,2H3;2,4H,1,3H2.
What are the key properties of methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol?
methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol has a molecular weight of 216.28 g/mol, XLogP of 1.04, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-hydroxy-2-methylidenehexanoate;prop-2-en-1-ol is sourced from PubChem (CID 174878856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).