About 3,4-dipentylcyclooctyne
3,4-dipentylcyclooctyne (PubChem CID 173035935) has the molecular formula C18H32
and a molecular weight of 248.45 g/mol. Its IUPAC name is 3,4-dipentylcyclooctyne.
Molecular Properties
| Compound Name | 3,4-dipentylcyclooctyne |
| PubChem CID | 173035935 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 3,4-dipentylcyclooctyne |
| SMILES | CCCCCC1C#CCCCCC1CCCCC |
| InChI | InChI=1S/C18H32/c1-3-5-9-13-17-15-11-7-8-12-16-18(17)14-10-6-4-2/h17-18H,3-11,13-15H2,1-2H3 |
| InChIKey | KHVUOOBDXZQKNW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dipentylcyclooctyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dipentylcyclooctyne?
The IUPAC name of 3,4-dipentylcyclooctyne (CID 173035935) is 3,4-dipentylcyclooctyne.
What is the SMILES notation for 3,4-dipentylcyclooctyne?
The canonical SMILES for 3,4-dipentylcyclooctyne is CCCCCC1C#CCCCCC1CCCCC.
What is the InChIKey of 3,4-dipentylcyclooctyne?
The InChIKey is KHVUOOBDXZQKNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32/c1-3-5-9-13-17-15-11-7-8-12-16-18(17)14-10-6-4-2/h17-18H,3-11,13-15H2,1-2H3.
What are the key properties of 3,4-dipentylcyclooctyne?
3,4-dipentylcyclooctyne has a molecular weight of 248.45 g/mol, XLogP of 5.96, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dipentylcyclooctyne is sourced from PubChem (CID 173035935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).