About CID 173038045
CID 173038045 (PubChem CID 173038045) has the molecular formula C19H31Sn
and a molecular weight of 378.17 g/mol.
Molecular Properties
| Compound Name | CID 173038045 |
| PubChem CID | 173038045 |
| Molecular Formula | C19H31Sn |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | — |
| SMILES | CCCCc1ccccc1C([Sn])(CCCC)CCCC |
| InChI | InChI=1S/C19H31.Sn/c1-4-7-12-17(13-8-5-2)19-16-11-10-15-18(19)14-9-6-3;/h10-11,15-16H,4-9,12-14H2,1-3H3; |
| InChIKey | OERJLSYDUXUZCZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 173038045 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173038045?
The IUPAC name of CID 173038045 (CID 173038045) is not available.
What is the SMILES notation for CID 173038045?
The canonical SMILES for CID 173038045 is CCCCc1ccccc1C([Sn])(CCCC)CCCC.
What is the InChIKey of CID 173038045?
The InChIKey is OERJLSYDUXUZCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31.Sn/c1-4-7-12-17(13-8-5-2)19-16-11-10-15-18(19)14-9-6-3;/h10-11,15-16H,4-9,12-14H2,1-3H3;.
What are the key properties of CID 173038045?
CID 173038045 has a molecular weight of 378.17 g/mol, XLogP of 5.77, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173038045 is sourced from PubChem (CID 173038045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).