C21H26N3O10PS — CID 173038881
3-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]sulfonylphenyl]-N-hydroxyprop-2-enamide;phosphoric acid (PubChem CID 173038881) has the molecular formula C21H26N3O10PS and a molecular weight of 543.49 g/mol. Its IUPAC name is 3-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]sulfonylphenyl]-N-hydroxyprop-2-enamide;phosphoric acid.
| Compound Name | 3-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]sulfonylphenyl]-N-hydroxyprop-2-enamide;phosphoric acid |
|---|---|
| PubChem CID | 173038881 |
| Molecular Formula | C21H26N3O10PS |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 3-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]sulfonylphenyl]-N-hydroxyprop-2-enamide;phosphoric acid |
| SMILES | O=C(C=Cc1ccccc1S(=O)(=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1)NO.O=P(O)(O)O |
| InChI | InChI=1S/C21H23N3O6S.H3O4P/c25-21(22-26)8-6-17-3-1-2-4-20(17)31(27,28)24-11-9-23(10-12-24)14-16-5-7-18-19(13-16)30-15-29-18;1-5(2,3)4/h1-8,13,26H,9-12,14-15H2,(H,22,25);(H3,1,2,3,4) |
| InChIKey | UJALMIJJHLWAGQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 186.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|