C48H72N8O4Si — CID 173039217
CID 173039217 (PubChem CID 173039217) has the molecular formula C48H72N8O4Si and a molecular weight of 853.24 g/mol.
| Compound Name | CID 173039217 |
|---|---|
| PubChem CID | 173039217 |
| Molecular Formula | C48H72N8O4Si |
| Molecular Weight | 853.24 g/mol |
| Exact Mass | 852.54 |
| IUPAC Name | — |
| SMILES | C1CCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C2C1.COc1cccc(C(C(=O)O)c2cccc(OC)c2)c1.[Si] |
| InChI | InChI=1S/C32H56N8.C16H16O4.Si/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;1-19-13-7-3-5-11(9-13)15(16(17)18)12-6-4-8-14(10-12)20-2;/h17-40H,1-16H2;3-10,15H,1-2H3,(H,17,18); |
| InChIKey | FTTVRWQKEUZUPY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.24 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|