C21H21Br2NO7P+ — CID 173041123
[1-[3,5-dibromo-4-[3-(4-carboxypiperidine-1-carbonyl)-4-hydroxyphenoxy]phenyl]-1-hydroxyethyl]-oxophosphanium (PubChem CID 173041123) has the molecular formula C21H21Br2NO7P+ and a molecular weight of 590.18 g/mol. Its IUPAC name is [1-[3,5-dibromo-4-[3-(4-carboxypiperidine-1-carbonyl)-4-hydroxyphenoxy]phenyl]-1-hydroxyethyl]-oxophosphanium.
| Compound Name | [1-[3,5-dibromo-4-[3-(4-carboxypiperidine-1-carbonyl)-4-hydroxyphenoxy]phenyl]-1-hydroxyethyl]-oxophosphanium |
|---|---|
| PubChem CID | 173041123 |
| Molecular Formula | C21H21Br2NO7P+ |
| Molecular Weight | 590.18 g/mol |
| Exact Mass | 587.94 |
| IUPAC Name | [1-[3,5-dibromo-4-[3-(4-carboxypiperidine-1-carbonyl)-4-hydroxyphenoxy]phenyl]-1-hydroxyethyl]-oxophosphanium |
| SMILES | CC(O)([PH+]=O)c1cc(Br)c(Oc2ccc(O)c(C(=O)N3CCC(C(=O)O)CC3)c2)c(Br)c1 |
| InChI | InChI=1S/C21H20Br2NO7P/c1-21(29,32-30)12-8-15(22)18(16(23)9-12)31-13-2-3-17(25)14(10-13)19(26)24-6-4-11(5-7-24)20(27)28/h2-3,8-11,25,29H,4-7H2,1H3,(H,27,28)/p+1 |
| InChIKey | JJLALKOOWACPRJ-UHFFFAOYSA-O |
| XLogP | 4.84 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.18 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|