C44H84NO8P — CID 173046039
[(2R)-4,5-di(octadec-9-enoyloxy)-2-(trimethylazaniumyl)pentyl] hydrogen phosphate (PubChem CID 173046039) has the molecular formula C44H84NO8P and a molecular weight of 786.13 g/mol. Its IUPAC name is [(2R)-4,5-di(octadec-9-enoyloxy)-2-(trimethylazaniumyl)pentyl] hydrogen phosphate.
| Compound Name | [(2R)-4,5-di(octadec-9-enoyloxy)-2-(trimethylazaniumyl)pentyl] hydrogen phosphate |
|---|---|
| PubChem CID | 173046039 |
| Molecular Formula | C44H84NO8P |
| Molecular Weight | 786.13 g/mol |
| Exact Mass | 785.59 |
| IUPAC Name | [(2R)-4,5-di(octadec-9-enoyloxy)-2-(trimethylazaniumyl)pentyl] hydrogen phosphate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(C[C@H](COP(=O)([O-])O)[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C44H84NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43(46)51-40-42(38-41(45(3,4)5)39-52-54(48,49)50)53-44(47)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,41-42H,6-19,24-40H2,1-5H3,(H-,48,49,50)/t41-,42?/m1/s1 |
| InChIKey | UNDHHFHXNUYKEI-HRCVVWNVSA-N |
| XLogP | 11.46 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.13 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|