C24H25N3O6S2 — CID 173046061
N-[4-[[3-(1-cyclohexylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-4-nitrobenzenesulfonamide (PubChem CID 173046061) has the molecular formula C24H25N3O6S2 and a molecular weight of 515.61 g/mol. Its IUPAC name is N-[4-[[3-(1-cyclohexylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[4-[[3-(1-cyclohexylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 173046061 |
| Molecular Formula | C24H25N3O6S2 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | N-[4-[[3-(1-cyclohexylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-4-nitrobenzenesulfonamide |
| SMILES | CC(C1CCCCC1)N1C(=O)SC(=Cc2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2)C1=O |
| InChI | InChI=1S/C24H25N3O6S2/c1-16(18-5-3-2-4-6-18)26-23(28)22(34-24(26)29)15-17-7-9-19(10-8-17)25-35(32,33)21-13-11-20(12-14-21)27(30)31/h7-16,18,25H,2-6H2,1H3 |
| InChIKey | FVKDQJQJSDSFTE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|