C22H36O4 — CID 173046309
2-methyl-3-[(9E,12E)-octadeca-9,12-dienoyl]oxyprop-2-enoic acid (PubChem CID 173046309) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-methyl-3-[(9E,12E)-octadeca-9,12-dienoyl]oxyprop-2-enoic acid.
| Compound Name | 2-methyl-3-[(9E,12E)-octadeca-9,12-dienoyl]oxyprop-2-enoic acid |
|---|---|
| PubChem CID | 173046309 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 2-methyl-3-[(9E,12E)-octadeca-9,12-dienoyl]oxyprop-2-enoic acid |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)OC=C(C)C(=O)O |
| InChI | InChI=1S/C22H36O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)26-19-20(2)22(24)25/h7-8,10-11,19H,3-6,9,12-18H2,1-2H3,(H,24,25)/b8-7+,11-10+,20-19? |
| InChIKey | AZEDYHSWHVBWIX-KWHNEWEVSA-N |
| XLogP | 6.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|