C22H36MgO4 — CID 173046372
magnesium;hydride;2-methyl-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyprop-2-enoic acid (PubChem CID 173046372) has the molecular formula C22H36MgO4 and a molecular weight of 388.83 g/mol. Its IUPAC name is magnesium;hydride;2-methyl-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyprop-2-enoic acid.
| Compound Name | magnesium;hydride;2-methyl-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyprop-2-enoic acid |
|---|---|
| PubChem CID | 173046372 |
| Molecular Formula | C22H36MgO4 |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | magnesium;hydride;2-methyl-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyprop-2-enoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC=C(C)C(=O)O.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C22H34O4.Mg.2H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)26-19-20(2)22(24)25;;;/h4-5,7-8,10-11,19H,3,6,9,12-18H2,1-2H3,(H,24,25);;;/q;+2;2*-1/b5-4-,8-7-,11-10-,20-19?;;; |
| InChIKey | SXSVWEIYZSJDFH-JQLRUHJISA-N |
| XLogP | 5.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|