C18H17F4N5 — CID 173049031
2-[2-(3-fluoro-4-methyl-2H-imidazol-1-yl)ethenyl]-8-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 173049031) has the molecular formula C18H17F4N5 and a molecular weight of 379.36 g/mol. Its IUPAC name is 2-[2-(3-fluoro-4-methyl-2H-imidazol-1-yl)ethenyl]-8-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-[2-(3-fluoro-4-methyl-2H-imidazol-1-yl)ethenyl]-8-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 173049031 |
| Molecular Formula | C18H17F4N5 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-[2-(3-fluoro-4-methyl-2H-imidazol-1-yl)ethenyl]-8-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC1=CN(C=Cc2nc3n(n2)CCCC3c2cc(F)c(F)c(F)c2)CN1F |
| InChI | InChI=1S/C18H17F4N5/c1-11-9-25(10-26(11)22)6-4-16-23-18-13(3-2-5-27(18)24-16)12-7-14(19)17(21)15(20)8-12/h4,6-9,13H,2-3,5,10H2,1H3 |
| InChIKey | LNNHTHKPUSMNKG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|