C25H22F3N5O — CID 24853006
2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(2,4,6-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 24853006) has the molecular formula C25H22F3N5O and a molecular weight of 465.48 g/mol. Its IUPAC name is 2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(2,4,6-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(2,4,6-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 24853006 |
| Molecular Formula | C25H22F3N5O |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(2,4,6-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cc(/C=C/c2nc3n(n2)CCCC3c2c(F)cc(F)cc2F)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H22F3N5O/c1-15-13-32(14-29-15)21-7-5-16(10-22(21)34-2)6-8-23-30-25-18(4-3-9-33(25)31-23)24-19(27)11-17(26)12-20(24)28/h5-8,10-14,18H,3-4,9H2,1-2H3/b8-6+ |
| InChIKey | YDESGKZGVHWNFJ-SOFGYWHQSA-N |
| XLogP | 5.29 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |