C25H24N6O2 — CID 88945139
2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(2-nitrosophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 88945139) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(2-nitrosophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(2-nitrosophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 88945139 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(2-nitrosophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cc(/C=C/c2nc3n(n2)CCCC3c2ccccc2N=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H24N6O2/c1-17-15-30(16-26-17)22-11-9-18(14-23(22)33-2)10-12-24-27-25-20(7-5-13-31(25)28-24)19-6-3-4-8-21(19)29-32/h3-4,6,8-12,14-16,20H,5,7,13H2,1-2H3/b12-10+ |
| InChIKey | VYPGVPRXUBIXHF-ZRDIBKRKSA-N |
| XLogP | 5.27 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |