C20H20N6O — CID 143770172
(8S)-2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile (PubChem CID 143770172) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is (8S)-2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile.
| Compound Name | (8S)-2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 143770172 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (8S)-2-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
| SMILES | COc1cc(/C=C/c2nc3n(n2)CCC[C@H]3C#N)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C20H20N6O/c1-14-12-25(13-22-14)17-7-5-15(10-18(17)27-2)6-8-19-23-20-16(11-21)4-3-9-26(20)24-19/h5-8,10,12-13,16H,3-4,9H2,1-2H3/b8-6+/t16-/m0/s1 |
| InChIKey | XTOUIOVAJNKQRL-BVBGJJFLSA-N |
| XLogP | 3.35 |
| TPSA | 81.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |