C22H25N5O — CID 66839149
8-cyclopropyl-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 66839149) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is 8-cyclopropyl-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-cyclopropyl-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 66839149 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 8-cyclopropyl-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cc(C=Cc2nc3n(n2)CCCC3C2CC2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C22H25N5O/c1-15-13-26(14-23-15)19-9-5-16(12-20(19)28-2)6-10-21-24-22-18(17-7-8-17)4-3-11-27(22)25-21/h5-6,9-10,12-14,17-18H,3-4,7-8,11H2,1-2H3 |
| InChIKey | VGSNPOSEEZYOCQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |