C24H23ClN6O — CID 76624838
8-(6-chloro-3-pyridinyl)-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 76624838) has the molecular formula C24H23ClN6O and a molecular weight of 446.94 g/mol. Its IUPAC name is 8-(6-chloro-3-pyridinyl)-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-(6-chloro-3-pyridinyl)-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 76624838 |
| Molecular Formula | C24H23ClN6O |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 8-(6-chloro-3-pyridinyl)-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cc(C=Cc2nc3n(n2)CCCC3c2ccc(Cl)nc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H23ClN6O/c1-16-14-30(15-27-16)20-8-5-17(12-21(20)32-2)6-10-23-28-24-19(4-3-11-31(24)29-23)18-7-9-22(25)26-13-18/h5-10,12-15,19H,3-4,11H2,1-2H3 |
| InChIKey | RIGWZXOPFNCZGN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|