C24H23ClN6 — CID 58105066
(8S)-8-(6-chloro-3-pyridinyl)-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 58105066) has the molecular formula C24H23ClN6 and a molecular weight of 430.94 g/mol. Its IUPAC name is (8S)-8-(6-chloro-3-pyridinyl)-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | (8S)-8-(6-chloro-3-pyridinyl)-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 58105066 |
| Molecular Formula | C24H23ClN6 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (8S)-8-(6-chloro-3-pyridinyl)-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cn(-c2ccc(/C=C/c3nc4n(n3)CCC[C@H]4c3ccc(Cl)nc3)cc2C)cn1 |
| InChI | InChI=1S/C24H23ClN6/c1-16-12-18(5-8-21(16)30-14-17(2)27-15-30)6-10-23-28-24-20(4-3-11-31(24)29-23)19-7-9-22(25)26-13-19/h5-10,12-15,20H,3-4,11H2,1-2H3/b10-6+/t20-/m0/s1 |
| InChIKey | URXRLBFGQAPJRU-FXVWLTTGSA-N |
| XLogP | 5.23 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|