C30H33N5O2 — CID 66839271
1-[4-[2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]phenyl]pentan-1-one (PubChem CID 66839271) has the molecular formula C30H33N5O2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 1-[4-[2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]phenyl]pentan-1-one.
| Compound Name | 1-[4-[2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]phenyl]pentan-1-one |
|---|---|
| PubChem CID | 66839271 |
| Molecular Formula | C30H33N5O2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 1-[4-[2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]phenyl]pentan-1-one |
| SMILES | CCCCC(=O)c1ccc(C2CCCn3nc(C=Cc4ccc(-n5cnc(C)c5)c(OC)c4)nc32)cc1 |
| InChI | InChI=1S/C30H33N5O2/c1-4-5-8-27(36)24-13-11-23(12-14-24)25-7-6-17-35-30(25)32-29(33-35)16-10-22-9-15-26(28(18-22)37-3)34-19-21(2)31-20-34/h9-16,18-20,25H,4-8,17H2,1-3H3 |
| InChIKey | AQJJJYCDPFVHFM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |