C26H32N6O2 — CID 90843935
1-[4-[(8R)-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]piperidin-1-yl]ethanone (PubChem CID 90843935) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-[4-[(8R)-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(8R)-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90843935 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 1-[4-[(8R)-2-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]piperidin-1-yl]ethanone |
| SMILES | COc1cc(C=Cc2nc3n(n2)CCC[C@@H]3C2CCN(C(C)=O)CC2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H32N6O2/c1-18-16-31(17-27-18)23-8-6-20(15-24(23)34-3)7-9-25-28-26-22(5-4-12-32(26)29-25)21-10-13-30(14-11-21)19(2)33/h6-9,15-17,21-22H,4-5,10-14H2,1-3H3/t22-/m1/s1 |
| InChIKey | GZFQYLJMVGWGDO-JOCHJYFZSA-N |
| XLogP | 4.09 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |