C24H20Cl2N4O2S — CID 17304943
2-[[5-[(2,5-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide (PubChem CID 17304943) has the molecular formula C24H20Cl2N4O2S and a molecular weight of 499.42 g/mol. Its IUPAC name is 2-[[5-[(2,5-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[[5-[(2,5-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 17304943 |
| Molecular Formula | C24H20Cl2N4O2S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 2-[[5-[(2,5-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
| SMILES | C=CCn1c(COc2cc(Cl)ccc2Cl)nnc1SCC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C24H20Cl2N4O2S/c1-2-12-30-22(14-32-21-13-17(25)10-11-19(21)26)28-29-24(30)33-15-23(31)27-20-9-5-7-16-6-3-4-8-18(16)20/h2-11,13H,1,12,14-15H2,(H,27,31) |
| InChIKey | GZDHLEADKZNYGG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|