C21H19Cl2N5O3S — CID 21167147
2-[[2-[[5-[(2,5-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide (PubChem CID 21167147) has the molecular formula C21H19Cl2N5O3S and a molecular weight of 492.39 g/mol. Its IUPAC name is 2-[[2-[[5-[(2,5-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[[5-[(2,5-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 21167147 |
| Molecular Formula | C21H19Cl2N5O3S |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 2-[[2-[[5-[(2,5-dichlorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide |
| SMILES | C=CCn1c(COc2cc(Cl)ccc2Cl)nnc1SCC(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C21H19Cl2N5O3S/c1-2-9-28-18(11-31-17-10-13(22)7-8-15(17)23)26-27-21(28)32-12-19(29)25-16-6-4-3-5-14(16)20(24)30/h2-8,10H,1,9,11-12H2,(H2,24,30)(H,25,29) |
| InChIKey | LWUKYNRGUIMKFL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|