C11H14N2O2S — CID 173052004
1-(1H-indol-2-yl)-N,N-dimethylmethanesulfonamide (PubChem CID 173052004) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 1-(1H-indol-2-yl)-N,N-dimethylmethanesulfonamide.
| Compound Name | 1-(1H-indol-2-yl)-N,N-dimethylmethanesulfonamide |
|---|---|
| PubChem CID | 173052004 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-(1H-indol-2-yl)-N,N-dimethylmethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H14N2O2S/c1-13(2)16(14,15)8-10-7-9-5-3-4-6-11(9)12-10/h3-7,12H,8H2,1-2H3 |
| InChIKey | HBCWMSYWJOYZHE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |